Mineral: | Tourmaline, Variety: Schorl
| Chemical Formula: | NaFe3+2Al6(BO3)3[Si6O18](OH)3(OH) | Size: | | Weight: | | Transparence: | | Quantity: | | Origin: | Shigar Valley, Skardu District, Baltistan, Northern Areas, Pakistan | Well sized unusual intergrown schorl crystal with doubly termination. The crystal is made out of three parallel intergrown crystals were one side disclosing recrystallized or felted surface, while the other end is showing the typical, more trigonal termination. Interesting item for any schorl collector.
| 
